C18H21BrN6 — CID 5328307
4-N-(3-bromophenyl)-7-N-[3-(dimethylamino)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328307) has the molecular formula C18H21BrN6 and a molecular weight of 401.31 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-7-N-[3-(dimethylamino)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(3-bromophenyl)-7-N-[3-(dimethylamino)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328307 |
| Molecular Formula | C18H21BrN6 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-N-(3-bromophenyl)-7-N-[3-(dimethylamino)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | CN(C)CCCNc1cc2ncnc(Nc3cccc(Br)c3)c2cn1 |
| InChI | InChI=1S/C18H21BrN6/c1-25(2)8-4-7-20-17-10-16-15(11-21-17)18(23-12-22-16)24-14-6-3-5-13(19)9-14/h3,5-6,9-12H,4,7-8H2,1-2H3,(H,20,21)(H,22,23,24) |
| InChIKey | KQABJETUKXUAAM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|