C19H23BrN6 — CID 5328308
4-N-(3-bromophenyl)-7-N-[4-(dimethylamino)butyl]pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328308) has the molecular formula C19H23BrN6 and a molecular weight of 415.34 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-7-N-[4-(dimethylamino)butyl]pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(3-bromophenyl)-7-N-[4-(dimethylamino)butyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328308 |
| Molecular Formula | C19H23BrN6 |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-N-(3-bromophenyl)-7-N-[4-(dimethylamino)butyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | CN(C)CCCCNc1cc2ncnc(Nc3cccc(Br)c3)c2cn1 |
| InChI | InChI=1S/C19H23BrN6/c1-26(2)9-4-3-8-21-18-11-17-16(12-22-18)19(24-13-23-17)25-15-7-5-6-14(20)10-15/h5-7,10-13H,3-4,8-9H2,1-2H3,(H,21,22)(H,23,24,25) |
| InChIKey | IQMLUMTUZSQCPT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|