C20H25BrN6 — CID 5328309
4-N-(3-bromophenyl)-7-N-[5-(dimethylamino)pentyl]pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328309) has the molecular formula C20H25BrN6 and a molecular weight of 429.37 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-7-N-[5-(dimethylamino)pentyl]pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(3-bromophenyl)-7-N-[5-(dimethylamino)pentyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328309 |
| Molecular Formula | C20H25BrN6 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-N-(3-bromophenyl)-7-N-[5-(dimethylamino)pentyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | CN(C)CCCCCNc1cc2ncnc(Nc3cccc(Br)c3)c2cn1 |
| InChI | InChI=1S/C20H25BrN6/c1-27(2)10-5-3-4-9-22-19-12-18-17(13-23-19)20(25-14-24-18)26-16-8-6-7-15(21)11-16/h6-8,11-14H,3-5,9-10H2,1-2H3,(H,22,23)(H,24,25,26) |
| InChIKey | QAUQFKRIRRUBIU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|