C21H25BrN6O — CID 5328313
4-N-(3-bromophenyl)-7-N-(4-morpholin-4-ylbutyl)pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328313) has the molecular formula C21H25BrN6O and a molecular weight of 457.38 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-7-N-(4-morpholin-4-ylbutyl)pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(3-bromophenyl)-7-N-(4-morpholin-4-ylbutyl)pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328313 |
| Molecular Formula | C21H25BrN6O |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 4-N-(3-bromophenyl)-7-N-(4-morpholin-4-ylbutyl)pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | Brc1cccc(Nc2ncnc3cc(NCCCCN4CCOCC4)ncc23)c1 |
| InChI | InChI=1S/C21H25BrN6O/c22-16-4-3-5-17(12-16)27-21-18-14-24-20(13-19(18)25-15-26-21)23-6-1-2-7-28-8-10-29-11-9-28/h3-5,12-15H,1-2,6-11H2,(H,23,24)(H,25,26,27) |
| InChIKey | LGQGASCJEHGWJL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|