C20H23BrN6O2 — CID 5328314
4-N-(3-bromophenyl)-7-N-[3-(4-oxidomorpholin-4-ium-4-yl)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328314) has the molecular formula C20H23BrN6O2 and a molecular weight of 459.35 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-7-N-[3-(4-oxidomorpholin-4-ium-4-yl)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(3-bromophenyl)-7-N-[3-(4-oxidomorpholin-4-ium-4-yl)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328314 |
| Molecular Formula | C20H23BrN6O2 |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 4-N-(3-bromophenyl)-7-N-[3-(4-oxidomorpholin-4-ium-4-yl)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | [O-][N+]1(CCCNc2cc3ncnc(Nc4cccc(Br)c4)c3cn2)CCOCC1 |
| InChI | InChI=1S/C20H23BrN6O2/c21-15-3-1-4-16(11-15)26-20-17-13-23-19(12-18(17)24-14-25-20)22-5-2-6-27(28)7-9-29-10-8-27/h1,3-4,11-14H,2,5-10H2,(H,22,23)(H,24,25,26) |
| InChIKey | NMCVYFXROBUBLX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|