C22H29N7 — CID 5328329
4-N-(3-methylphenyl)-7-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328329) has the molecular formula C22H29N7 and a molecular weight of 391.52 g/mol. Its IUPAC name is 4-N-(3-methylphenyl)-7-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(3-methylphenyl)-7-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328329 |
| Molecular Formula | C22H29N7 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 4-N-(3-methylphenyl)-7-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | Cc1cccc(Nc2ncnc3cc(NCCCN4CCN(C)CC4)ncc23)c1 |
| InChI | InChI=1S/C22H29N7/c1-17-5-3-6-18(13-17)27-22-19-15-24-21(14-20(19)25-16-26-22)23-7-4-8-29-11-9-28(2)10-12-29/h3,5-6,13-16H,4,7-12H2,1-2H3,(H,23,24)(H,25,26,27) |
| InChIKey | ZSWVFFAVTCICJD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|