C20H22F2N2O — CID 53283469
N-(3,4-difluorophenyl)-4-[(3-methylpiperidin-1-yl)methyl]benzamide (PubChem CID 53283469) has the molecular formula C20H22F2N2O and a molecular weight of 344.41 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-[(3-methylpiperidin-1-yl)methyl]benzamide.
| Compound Name | N-(3,4-difluorophenyl)-4-[(3-methylpiperidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53283469 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-[(3-methylpiperidin-1-yl)methyl]benzamide |
| SMILES | CC1CCCN(Cc2ccc(C(=O)Nc3ccc(F)c(F)c3)cc2)C1 |
| InChI | InChI=1S/C20H22F2N2O/c1-14-3-2-10-24(12-14)13-15-4-6-16(7-5-15)20(25)23-17-8-9-18(21)19(22)11-17/h4-9,11,14H,2-3,10,12-13H2,1H3,(H,23,25) |
| InChIKey | CWEGTISRNKPRRT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |