C21H26N6O — CID 5328379
4-N-(3-methylphenyl)-6-N-(3-morpholin-4-ylpropyl)pyrido[3,4-d]pyrimidine-4,6-diamine (PubChem CID 5328379) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-N-(3-methylphenyl)-6-N-(3-morpholin-4-ylpropyl)pyrido[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-methylphenyl)-6-N-(3-morpholin-4-ylpropyl)pyrido[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 5328379 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-N-(3-methylphenyl)-6-N-(3-morpholin-4-ylpropyl)pyrido[3,4-d]pyrimidine-4,6-diamine |
| SMILES | Cc1cccc(Nc2ncnc3cnc(NCCCN4CCOCC4)cc23)c1 |
| InChI | InChI=1S/C21H26N6O/c1-16-4-2-5-17(12-16)26-21-18-13-20(23-14-19(18)24-15-25-21)22-6-3-7-27-8-10-28-11-9-27/h2,4-5,12-15H,3,6-11H2,1H3,(H,22,23)(H,24,25,26) |
| InChIKey | BJYJRYMXVLVRPI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|