C18H16N4 — CID 5328387
N-[(1R)-1-phenylethyl]-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 5328387) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | N-[(1R)-1-phenylethyl]-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 5328387 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | C[C@@H](Nc1ncnc2c1[nH]c1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C18H16N4/c1-12(13-7-3-2-4-8-13)21-18-17-16(19-11-20-18)14-9-5-6-10-15(14)22-17/h2-12,22H,1H3,(H,19,20,21)/t12-/m1/s1 |
| InChIKey | LITMWRKODNTXFW-GFCCVEGCSA-N |
| XLogP | 4.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |