About 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine
4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine (PubChem CID 5328396) has the molecular formula C16H12BrN5
and a molecular weight of 354.21 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine |
| PubChem CID | 5328396 |
| Molecular Formula | C16H12BrN5 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine |
| SMILES | Nc1nc(Nc2cccc(Br)c2)c2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C16H12BrN5/c17-9-4-3-5-10(8-9)19-14-13-11-6-1-2-7-12(11)20-15(13)22-16(18)21-14/h1-8H,(H4,18,19,20,21,22) |
| InChIKey | NOUNTOCKLNSANP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine?
The IUPAC name of 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine (CID 5328396) is 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine.
What is the SMILES notation for 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine?
The canonical SMILES for 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine is Nc1nc(Nc2cccc(Br)c2)c2c(n1)[nH]c1ccccc12.
What is the InChIKey of 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine?
The InChIKey is NOUNTOCKLNSANP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrN5/c17-9-4-3-5-10(8-9)19-14-13-11-6-1-2-7-12(11)20-15(13)22-16(18)21-14/h1-8H,(H4,18,19,20,21,22).
What are the key properties of 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine?
4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine has a molecular weight of 354.21 g/mol, XLogP of 4.20, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(3-bromophenyl)-9H-pyrimido[4,5-b]indole-2,4-diamine is sourced from PubChem (CID 5328396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).