About 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine
8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine (PubChem CID 5328402) has the molecular formula C16H10N4O2S
and a molecular weight of 322.35 g/mol. Its IUPAC name is 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
| PubChem CID | 5328402 |
| Molecular Formula | C16H10N4O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1ccc2sc3c(Nc4ccccc4)ncnc3c2c1 |
| InChI | InChI=1S/C16H10N4O2S/c21-20(22)11-6-7-13-12(8-11)14-15(23-13)16(18-9-17-14)19-10-4-2-1-3-5-10/h1-9H,(H,17,18,19) |
| InChIKey | NOBQECCESYXWPW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine?
The IUPAC name of 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine (CID 5328402) is 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine is O=[N+]([O-])c1ccc2sc3c(Nc4ccccc4)ncnc3c2c1.
What is the InChIKey of 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine?
The InChIKey is NOBQECCESYXWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4O2S/c21-20(22)11-6-7-13-12(8-11)14-15(23-13)16(18-9-17-14)19-10-4-2-1-3-5-10/h1-9H,(H,17,18,19).
What are the key properties of 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine?
8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine has a molecular weight of 322.35 g/mol, XLogP of 4.50, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitro-N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 5328402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).