About 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine
4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine (PubChem CID 5328412) has the molecular formula C16H10BrFN4S
and a molecular weight of 389.25 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine.
Molecular Properties
| Compound Name | 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine |
| PubChem CID | 5328412 |
| Molecular Formula | C16H10BrFN4S |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine |
| SMILES | Nc1cc2sc3c(Nc4cccc(Br)c4)ncnc3c2cc1F |
| InChI | InChI=1S/C16H10BrFN4S/c17-8-2-1-3-9(4-8)22-16-15-14(20-7-21-16)10-5-11(18)12(19)6-13(10)23-15/h1-7H,19H2,(H,20,21,22) |
| InChIKey | GYZDLQGLTSJPMG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine?
The IUPAC name of 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine (CID 5328412) is 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine.
What is the SMILES notation for 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine?
The canonical SMILES for 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine is Nc1cc2sc3c(Nc4cccc(Br)c4)ncnc3c2cc1F.
What is the InChIKey of 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine?
The InChIKey is GYZDLQGLTSJPMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrFN4S/c17-8-2-1-3-9(4-8)22-16-15-14(20-7-21-16)10-5-11(18)12(19)6-13(10)23-15/h1-7H,19H2,(H,20,21,22).
What are the key properties of 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine?
4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine has a molecular weight of 389.25 g/mol, XLogP of 5.07, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(3-bromophenyl)-8-fluoro-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine is sourced from PubChem (CID 5328412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).