C15H9ClN4S — CID 5328422
N-(3-chlorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 5328422) has the molecular formula C15H9ClN4S and a molecular weight of 312.79 g/mol. Its IUPAC name is N-(3-chlorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | N-(3-chlorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 5328422 |
| Molecular Formula | C15H9ClN4S |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | N-(3-chlorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Clc1cccc(Nc2ncnc3c2sc2ncccc23)c1 |
| InChI | InChI=1S/C15H9ClN4S/c16-9-3-1-4-10(7-9)20-14-13-12(18-8-19-14)11-5-2-6-17-15(11)21-13/h1-8H,(H,18,19,20) |
| InChIKey | LRYUYVGCKNONRJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |