About 3-phenylimidazo[4,5-b]pyridine
3-phenylimidazo[4,5-b]pyridine (PubChem CID 5328491) has the molecular formula C12H9N3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-phenylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3-phenylimidazo[4,5-b]pyridine |
| PubChem CID | 5328491 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 3-phenylimidazo[4,5-b]pyridine |
| SMILES | c1ccc(-n2cnc3cccnc32)cc1 |
| InChI | InChI=1S/C12H9N3/c1-2-5-10(6-3-1)15-9-14-11-7-4-8-13-12(11)15/h1-9H |
| InChIKey | AGQWNWPWJSILEU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylimidazo[4,5-b]pyridine?
The IUPAC name of 3-phenylimidazo[4,5-b]pyridine (CID 5328491) is 3-phenylimidazo[4,5-b]pyridine.
What is the SMILES notation for 3-phenylimidazo[4,5-b]pyridine?
The canonical SMILES for 3-phenylimidazo[4,5-b]pyridine is c1ccc(-n2cnc3cccnc32)cc1.
What is the InChIKey of 3-phenylimidazo[4,5-b]pyridine?
The InChIKey is AGQWNWPWJSILEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3/c1-2-5-10(6-3-1)15-9-14-11-7-4-8-13-12(11)15/h1-9H.
What are the key properties of 3-phenylimidazo[4,5-b]pyridine?
3-phenylimidazo[4,5-b]pyridine has a molecular weight of 195.22 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylimidazo[4,5-b]pyridine is sourced from PubChem (CID 5328491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).