About 1-phenylbenzimidazole-4,5-diol
1-phenylbenzimidazole-4,5-diol (PubChem CID 5328517) has the molecular formula C13H10N2O2
and a molecular weight of 226.24 g/mol. Its IUPAC name is 1-phenylbenzimidazole-4,5-diol.
Molecular Properties
| Compound Name | 1-phenylbenzimidazole-4,5-diol |
| PubChem CID | 5328517 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-phenylbenzimidazole-4,5-diol |
| SMILES | Oc1ccc2c(ncn2-c2ccccc2)c1O |
| InChI | InChI=1S/C13H10N2O2/c16-11-7-6-10-12(13(11)17)14-8-15(10)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | SMKKNSYFQFENDV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylbenzimidazole-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylbenzimidazole-4,5-diol?
The IUPAC name of 1-phenylbenzimidazole-4,5-diol (CID 5328517) is 1-phenylbenzimidazole-4,5-diol.
What is the SMILES notation for 1-phenylbenzimidazole-4,5-diol?
The canonical SMILES for 1-phenylbenzimidazole-4,5-diol is Oc1ccc2c(ncn2-c2ccccc2)c1O.
What is the InChIKey of 1-phenylbenzimidazole-4,5-diol?
The InChIKey is SMKKNSYFQFENDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2/c16-11-7-6-10-12(13(11)17)14-8-15(10)9-4-2-1-3-5-9/h1-8,16-17H.
What are the key properties of 1-phenylbenzimidazole-4,5-diol?
1-phenylbenzimidazole-4,5-diol has a molecular weight of 226.24 g/mol, XLogP of 2.44, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylbenzimidazole-4,5-diol is sourced from PubChem (CID 5328517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).