About methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate
methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate (PubChem CID 5328549) has the molecular formula C20H25NO6S
and a molecular weight of 407.49 g/mol. Its IUPAC name is methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate |
| PubChem CID | 5328549 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate |
| SMILES | COC(=O)CCN1C(=S)C(CCC(=O)OC)(CCC(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C20H25NO6S/c1-25-16(22)8-11-20(12-9-17(23)26-2)14-6-4-5-7-15(14)21(19(20)28)13-10-18(24)27-3/h4-7H,8-13H2,1-3H3 |
| InChIKey | GJMGVLXXCHTSIG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate?
The IUPAC name of methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate (CID 5328549) is methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate.
What is the SMILES notation for methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate?
The canonical SMILES for methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate is COC(=O)CCN1C(=S)C(CCC(=O)OC)(CCC(=O)OC)c2ccccc21.
What is the InChIKey of methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate?
The InChIKey is GJMGVLXXCHTSIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO6S/c1-25-16(22)8-11-20(12-9-17(23)26-2)14-6-4-5-7-15(14)21(19(20)28)13-10-18(24)27-3/h4-7H,8-13H2,1-3H3.
What are the key properties of methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate?
methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate has a molecular weight of 407.49 g/mol, XLogP of 2.54, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1,3-bis(3-methoxy-3-oxopropyl)-2-sulfanylideneindol-3-yl]propanoate is sourced from PubChem (CID 5328549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).