C34H30N4O2S2 — CID 5328608
2-[[1,6-dimethyl-3-(phenylcarbamoyl)indol-2-yl]disulfanyl]-1,6-dimethyl-N-phenylindole-3-carboxamide (PubChem CID 5328608) has the molecular formula C34H30N4O2S2 and a molecular weight of 590.77 g/mol. Its IUPAC name is 2-[[1,6-dimethyl-3-(phenylcarbamoyl)indol-2-yl]disulfanyl]-1,6-dimethyl-N-phenylindole-3-carboxamide.
| Compound Name | 2-[[1,6-dimethyl-3-(phenylcarbamoyl)indol-2-yl]disulfanyl]-1,6-dimethyl-N-phenylindole-3-carboxamide |
|---|---|
| PubChem CID | 5328608 |
| Molecular Formula | C34H30N4O2S2 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | 2-[[1,6-dimethyl-3-(phenylcarbamoyl)indol-2-yl]disulfanyl]-1,6-dimethyl-N-phenylindole-3-carboxamide |
| SMILES | Cc1ccc2c(C(=O)Nc3ccccc3)c(SSc3c(C(=O)Nc4ccccc4)c4ccc(C)cc4n3C)n(C)c2c1 |
| InChI | InChI=1S/C34H30N4O2S2/c1-21-15-17-25-27(19-21)37(3)33(29(25)31(39)35-23-11-7-5-8-12-23)41-42-34-30(32(40)36-24-13-9-6-10-14-24)26-18-16-22(2)20-28(26)38(34)4/h5-20H,1-4H3,(H,35,39)(H,36,40) |
| InChIKey | RIWLLXKPZKILLE-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|