About 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one
2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 5328628) has the molecular formula C17H16Cl2N4O
and a molecular weight of 363.25 g/mol. Its IUPAC name is 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 5328628 |
| Molecular Formula | C17H16Cl2N4O |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(C)Cn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(N)nc21 |
| InChI | InChI=1S/C17H16Cl2N4O/c1-9(2)8-23-15-10(7-21-17(20)22-15)6-11(16(23)24)14-12(18)4-3-5-13(14)19/h3-7,9H,8H2,1-2H3,(H2,20,21,22) |
| InChIKey | AQUXBIDNWAFZLO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one (CID 5328628) is 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one is CC(C)Cn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(N)nc21.
What is the InChIKey of 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is AQUXBIDNWAFZLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2N4O/c1-9(2)8-23-15-10(7-21-17(20)22-15)6-11(16(23)24)14-12(18)4-3-5-13(14)19/h3-7,9H,8H2,1-2H3,(H2,20,21,22).
What are the key properties of 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one?
2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 363.25 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(2,6-dichlorophenyl)-8-(2-methylpropyl)pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 5328628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).