C19H16N4OS — CID 5328648
2-anilino-8-ethyl-6-thiophen-3-ylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5328648) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-anilino-8-ethyl-6-thiophen-3-ylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-anilino-8-ethyl-6-thiophen-3-ylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5328648 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-anilino-8-ethyl-6-thiophen-3-ylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccsc2)cc2cnc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C19H16N4OS/c1-2-23-17-14(10-16(18(23)24)13-8-9-25-12-13)11-20-19(22-17)21-15-6-4-3-5-7-15/h3-12H,2H2,1H3,(H,20,21,22) |
| InChIKey | WPUHUROYCYWEDW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |