About 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one
2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5328650) has the molecular formula C27H31N5O2
and a molecular weight of 457.58 g/mol. Its IUPAC name is 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 5328650 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCN(CC)CCOc1ccc(Nc2ncc3cc(-c4ccccc4)c(=O)n(CC)c3n2)cc1 |
| InChI | InChI=1S/C27H31N5O2/c1-4-31(5-2)16-17-34-23-14-12-22(13-15-23)29-27-28-19-21-18-24(20-10-8-7-9-11-20)26(33)32(6-3)25(21)30-27/h7-15,18-19H,4-6,16-17H2,1-3H3,(H,28,29,30) |
| InChIKey | CUAUTGRQMYJPFC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one (CID 5328650) is 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one is CCN(CC)CCOc1ccc(Nc2ncc3cc(-c4ccccc4)c(=O)n(CC)c3n2)cc1.
What is the InChIKey of 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one?
The InChIKey is CUAUTGRQMYJPFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N5O2/c1-4-31(5-2)16-17-34-23-14-12-22(13-15-23)29-27-28-19-21-18-24(20-10-8-7-9-11-20)26(33)32(6-3)25(21)30-27/h7-15,18-19H,4-6,16-17H2,1-3H3,(H,28,29,30).
What are the key properties of 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one?
2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one has a molecular weight of 457.58 g/mol, XLogP of 4.94, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(diethylamino)ethoxy]anilino]-8-ethyl-6-phenylpyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 5328650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).