About 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one
5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one (PubChem CID 5328656) has the molecular formula C20H15NO5
and a molecular weight of 349.34 g/mol. Its IUPAC name is 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one.
Molecular Properties
| Compound Name | 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one |
| PubChem CID | 5328656 |
| Molecular Formula | C20H15NO5 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one |
| SMILES | O=c1c2c(O)c(O)ccc2c2cc(O)c(O)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C20H15NO5/c22-15-7-6-12-13-8-16(23)17(24)9-14(13)21(20(26)18(12)19(15)25)10-11-4-2-1-3-5-11/h1-9,22-25H,10H2 |
| InChIKey | XNUDZGSOZAWWNT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one?
The IUPAC name of 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one (CID 5328656) is 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one.
What is the SMILES notation for 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one?
The canonical SMILES for 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one is O=c1c2c(O)c(O)ccc2c2cc(O)c(O)cc2n1Cc1ccccc1.
What is the InChIKey of 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one?
The InChIKey is XNUDZGSOZAWWNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO5/c22-15-7-6-12-13-8-16(23)17(24)9-14(13)21(20(26)18(12)19(15)25)10-11-4-2-1-3-5-11/h1-9,22-25H,10H2.
What are the key properties of 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one?
5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one has a molecular weight of 349.34 g/mol, XLogP of 3.03, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2,3,7,8-tetrahydroxyphenanthridin-6-one is sourced from PubChem (CID 5328656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).