About 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol
9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol (PubChem CID 5328670) has the molecular formula C18H14N2O4
and a molecular weight of 322.32 g/mol. Its IUPAC name is 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol.
Molecular Properties
| Compound Name | 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol |
| PubChem CID | 5328670 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol |
| SMILES | Oc1cc2c3cc(O)c(O)cc3n(Cc3cccnc3)c2cc1O |
| InChI | InChI=1S/C18H14N2O4/c21-15-4-11-12-5-16(22)18(24)7-14(12)20(13(11)6-17(15)23)9-10-2-1-3-19-8-10/h1-8,21-24H,9H2 |
| InChIKey | PLQMWNIIDRRFJW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol?
The IUPAC name of 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol (CID 5328670) is 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol.
What is the SMILES notation for 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol?
The canonical SMILES for 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol is Oc1cc2c3cc(O)c(O)cc3n(Cc3cccnc3)c2cc1O.
What is the InChIKey of 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol?
The InChIKey is PLQMWNIIDRRFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O4/c21-15-4-11-12-5-16(22)18(24)7-14(12)20(13(11)6-17(15)23)9-10-2-1-3-19-8-10/h1-8,21-24H,9H2.
What are the key properties of 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol?
9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol has a molecular weight of 322.32 g/mol, XLogP of 3.06, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(pyridin-3-ylmethyl)carbazole-2,3,6,7-tetrol is sourced from PubChem (CID 5328670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).