C22H26Cl2N4O — CID 5328704
3-(2,6-dichlorophenyl)-7-[3-(diethylamino)propylamino]-1-methyl-1,6-naphthyridin-2-one (PubChem CID 5328704) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[3-(diethylamino)propylamino]-1-methyl-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[3-(diethylamino)propylamino]-1-methyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 5328704 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[3-(diethylamino)propylamino]-1-methyl-1,6-naphthyridin-2-one |
| SMILES | CCN(CC)CCCNc1cc2c(cn1)cc(-c1c(Cl)cccc1Cl)c(=O)n2C |
| InChI | InChI=1S/C22H26Cl2N4O/c1-4-28(5-2)11-7-10-25-20-13-19-15(14-26-20)12-16(22(29)27(19)3)21-17(23)8-6-9-18(21)24/h6,8-9,12-14H,4-5,7,10-11H2,1-3H3,(H,25,26) |
| InChIKey | DHTNVMBSGAPRGN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|