C24H30Cl2N4O — CID 5328706
3-(2,6-dichlorophenyl)-7-[5-(diethylamino)pentylamino]-1-methyl-1,6-naphthyridin-2-one (PubChem CID 5328706) has the molecular formula C24H30Cl2N4O and a molecular weight of 461.44 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[5-(diethylamino)pentylamino]-1-methyl-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[5-(diethylamino)pentylamino]-1-methyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 5328706 |
| Molecular Formula | C24H30Cl2N4O |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[5-(diethylamino)pentylamino]-1-methyl-1,6-naphthyridin-2-one |
| SMILES | CCN(CC)CCCCCNc1cc2c(cn1)cc(-c1c(Cl)cccc1Cl)c(=O)n2C |
| InChI | InChI=1S/C24H30Cl2N4O/c1-4-30(5-2)13-8-6-7-12-27-22-15-21-17(16-28-22)14-18(24(31)29(21)3)23-19(25)10-9-11-20(23)26/h9-11,14-16H,4-8,12-13H2,1-3H3,(H,27,28) |
| InChIKey | YRRHAVKHTFWTLV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|