C22H24Cl2N4O2 — CID 5328710
3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylpropylamino)-1,6-naphthyridin-2-one (PubChem CID 5328710) has the molecular formula C22H24Cl2N4O2 and a molecular weight of 447.37 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylpropylamino)-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylpropylamino)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 5328710 |
| Molecular Formula | C22H24Cl2N4O2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1-methyl-7-(3-morpholin-4-ylpropylamino)-1,6-naphthyridin-2-one |
| SMILES | Cn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(NCCCN3CCOCC3)cc21 |
| InChI | InChI=1S/C22H24Cl2N4O2/c1-27-19-13-20(25-6-3-7-28-8-10-30-11-9-28)26-14-15(19)12-16(22(27)29)21-17(23)4-2-5-18(21)24/h2,4-5,12-14H,3,6-11H2,1H3,(H,25,26) |
| InChIKey | CYFCBAYGOYPBEA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|