C21H19Cl2N5O — CID 5328712
3-(2,6-dichlorophenyl)-7-(3-imidazol-1-ylpropylamino)-1-methyl-1,6-naphthyridin-2-one (PubChem CID 5328712) has the molecular formula C21H19Cl2N5O and a molecular weight of 428.32 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-(3-imidazol-1-ylpropylamino)-1-methyl-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-(3-imidazol-1-ylpropylamino)-1-methyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 5328712 |
| Molecular Formula | C21H19Cl2N5O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-(3-imidazol-1-ylpropylamino)-1-methyl-1,6-naphthyridin-2-one |
| SMILES | Cn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(NCCCn3ccnc3)cc21 |
| InChI | InChI=1S/C21H19Cl2N5O/c1-27-18-11-19(25-6-3-8-28-9-7-24-13-28)26-12-14(18)10-15(21(27)29)20-16(22)4-2-5-17(20)23/h2,4-5,7,9-13H,3,6,8H2,1H3,(H,25,26) |
| InChIKey | BSMKGOSXJLCJOB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|