About 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one
3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one (PubChem CID 5328715) has the molecular formula C22H17Cl2N3O2
and a molecular weight of 426.30 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one |
| PubChem CID | 5328715 |
| Molecular Formula | C22H17Cl2N3O2 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one |
| SMILES | COc1ccc(Nc2cc3c(cn2)cc(-c2c(Cl)cccc2Cl)c(=O)n3C)cc1 |
| InChI | InChI=1S/C22H17Cl2N3O2/c1-27-19-11-20(26-14-6-8-15(29-2)9-7-14)25-12-13(19)10-16(22(27)28)21-17(23)4-3-5-18(21)24/h3-12H,1-2H3,(H,25,26) |
| InChIKey | QQLWYDYVUOBKGW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one?
The IUPAC name of 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one (CID 5328715) is 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one.
What is the SMILES notation for 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one?
The canonical SMILES for 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one is COc1ccc(Nc2cc3c(cn2)cc(-c2c(Cl)cccc2Cl)c(=O)n3C)cc1.
What is the InChIKey of 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one?
The InChIKey is QQLWYDYVUOBKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Cl2N3O2/c1-27-19-11-20(26-14-6-8-15(29-2)9-7-14)25-12-13(19)10-16(22(27)28)21-17(23)4-3-5-18(21)24/h3-12H,1-2H3,(H,25,26).
What are the key properties of 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one?
3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one has a molecular weight of 426.30 g/mol, XLogP of 5.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)-7-(4-methoxyanilino)-1-methyl-1,6-naphthyridin-2-one is sourced from PubChem (CID 5328715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).