C28H30Cl2N4O2 — CID 5328717
3-(2,6-dichlorophenyl)-7-[4-[3-(diethylamino)propoxy]anilino]-1-methyl-1,6-naphthyridin-2-one (PubChem CID 5328717) has the molecular formula C28H30Cl2N4O2 and a molecular weight of 525.48 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[4-[3-(diethylamino)propoxy]anilino]-1-methyl-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[4-[3-(diethylamino)propoxy]anilino]-1-methyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 5328717 |
| Molecular Formula | C28H30Cl2N4O2 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[4-[3-(diethylamino)propoxy]anilino]-1-methyl-1,6-naphthyridin-2-one |
| SMILES | CCN(CC)CCCOc1ccc(Nc2cc3c(cn2)cc(-c2c(Cl)cccc2Cl)c(=O)n3C)cc1 |
| InChI | InChI=1S/C28H30Cl2N4O2/c1-4-34(5-2)14-7-15-36-21-12-10-20(11-13-21)32-26-17-25-19(18-31-26)16-22(28(35)33(25)3)27-23(29)8-6-9-24(27)30/h6,8-13,16-18H,4-5,7,14-15H2,1-3H3,(H,31,32) |
| InChIKey | JKSJVFXGQAODGT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|