C29H31Cl2N5O2 — CID 5328719
3-(2,6-dichlorophenyl)-1-methyl-7-[4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]-1,6-naphthyridin-2-one (PubChem CID 5328719) has the molecular formula C29H31Cl2N5O2 and a molecular weight of 552.51 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1-methyl-7-[4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-1-methyl-7-[4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 5328719 |
| Molecular Formula | C29H31Cl2N5O2 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1-methyl-7-[4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]-1,6-naphthyridin-2-one |
| SMILES | CN1CCN(CCCOc2ccc(Nc3cc4c(cn3)cc(-c3c(Cl)cccc3Cl)c(=O)n4C)cc2)CC1 |
| InChI | InChI=1S/C29H31Cl2N5O2/c1-34-12-14-36(15-13-34)11-4-16-38-22-9-7-21(8-10-22)33-27-18-26-20(19-32-27)17-23(29(37)35(26)2)28-24(30)5-3-6-25(28)31/h3,5-10,17-19H,4,11-16H2,1-2H3,(H,32,33) |
| InChIKey | PQZDDSNPXGLODE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|