C26H25Cl2N5O — CID 5328720
3-(2,6-dichlorophenyl)-1-methyl-7-[4-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one (PubChem CID 5328720) has the molecular formula C26H25Cl2N5O and a molecular weight of 494.43 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1-methyl-7-[4-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-1-methyl-7-[4-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 5328720 |
| Molecular Formula | C26H25Cl2N5O |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1-methyl-7-[4-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one |
| SMILES | CN1CCN(c2ccc(Nc3cc4c(cn3)cc(-c3c(Cl)cccc3Cl)c(=O)n4C)cc2)CC1 |
| InChI | InChI=1S/C26H25Cl2N5O/c1-31-10-12-33(13-11-31)19-8-6-18(7-9-19)30-24-15-23-17(16-29-24)14-20(26(34)32(23)2)25-21(27)4-3-5-22(25)28/h3-9,14-16H,10-13H2,1-2H3,(H,29,30) |
| InChIKey | GMKQAXFNIGTRDK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|