About 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one
7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one (PubChem CID 5328729) has the molecular formula C21H15Cl2N3O
and a molecular weight of 396.28 g/mol. Its IUPAC name is 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one |
| PubChem CID | 5328729 |
| Molecular Formula | C21H15Cl2N3O |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one |
| SMILES | Cn1c(=O)c(-c2c(Cl)cccc2Cl)cc2ccc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C21H15Cl2N3O/c1-26-20-13(10-11-18(25-20)24-14-6-3-2-4-7-14)12-15(21(26)27)19-16(22)8-5-9-17(19)23/h2-12H,1H3,(H,24,25) |
| InChIKey | FQUIMIMTKNYGHC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one?
The IUPAC name of 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one (CID 5328729) is 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one.
What is the SMILES notation for 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one?
The canonical SMILES for 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one is Cn1c(=O)c(-c2c(Cl)cccc2Cl)cc2ccc(Nc3ccccc3)nc21.
What is the InChIKey of 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one?
The InChIKey is FQUIMIMTKNYGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15Cl2N3O/c1-26-20-13(10-11-18(25-20)24-14-6-3-2-4-7-14)12-15(21(26)27)19-16(22)8-5-9-17(19)23/h2-12H,1H3,(H,24,25).
What are the key properties of 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one?
7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one has a molecular weight of 396.28 g/mol, XLogP of 5.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-anilino-3-(2,6-dichlorophenyl)-1-methyl-1,8-naphthyridin-2-one is sourced from PubChem (CID 5328729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).