C20H25FN2O3S — CID 53287826
4-(4-ethyl-N-methylsulfonylanilino)-N-[(3-fluorophenyl)methyl]butanamide (PubChem CID 53287826) has the molecular formula C20H25FN2O3S and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-(4-ethyl-N-methylsulfonylanilino)-N-[(3-fluorophenyl)methyl]butanamide.
| Compound Name | 4-(4-ethyl-N-methylsulfonylanilino)-N-[(3-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 53287826 |
| Molecular Formula | C20H25FN2O3S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 4-(4-ethyl-N-methylsulfonylanilino)-N-[(3-fluorophenyl)methyl]butanamide |
| SMILES | CCc1ccc(N(CCCC(=O)NCc2cccc(F)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H25FN2O3S/c1-3-16-9-11-19(12-10-16)23(27(2,25)26)13-5-8-20(24)22-15-17-6-4-7-18(21)14-17/h4,6-7,9-12,14H,3,5,8,13,15H2,1-2H3,(H,22,24) |
| InChIKey | AVJOFHBKOBMAOT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |