C13H7BrN4O2 — CID 5328809
(3Z)-2-amino-4-(3-bromo-4,5-dihydroxyphenyl)buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 5328809) has the molecular formula C13H7BrN4O2 and a molecular weight of 331.13 g/mol. Its IUPAC name is (3Z)-2-amino-4-(3-bromo-4,5-dihydroxyphenyl)buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | (3Z)-2-amino-4-(3-bromo-4,5-dihydroxyphenyl)buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 5328809 |
| Molecular Formula | C13H7BrN4O2 |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | (3Z)-2-amino-4-(3-bromo-4,5-dihydroxyphenyl)buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(C#N)=C(N)/C(C#N)=C/c1cc(O)c(O)c(Br)c1 |
| InChI | InChI=1S/C13H7BrN4O2/c14-10-2-7(3-11(19)13(10)20)1-8(4-15)12(18)9(5-16)6-17/h1-3,19-20H,18H2/b8-1+ |
| InChIKey | RMDQRGMZCBNAHG-UNXLUWIOSA-N |
| XLogP | 2.03 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|