About 2-bromo-N,N-dioctylacetamide
2-bromo-N,N-dioctylacetamide (PubChem CID 532882) has the molecular formula C18H36BrNO
and a molecular weight of 362.40 g/mol. Its IUPAC name is 2-bromo-N,N-dioctylacetamide.
Molecular Properties
| Compound Name | 2-bromo-N,N-dioctylacetamide |
| PubChem CID | 532882 |
| Molecular Formula | C18H36BrNO |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-bromo-N,N-dioctylacetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)CBr |
| InChI | InChI=1S/C18H36BrNO/c1-3-5-7-9-11-13-15-20(18(21)17-19)16-14-12-10-8-6-4-2/h3-17H2,1-2H3 |
| InChIKey | XEFDAMQSIJLBRD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N,N-dioctylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N,N-dioctylacetamide?
The IUPAC name of 2-bromo-N,N-dioctylacetamide (CID 532882) is 2-bromo-N,N-dioctylacetamide.
What is the SMILES notation for 2-bromo-N,N-dioctylacetamide?
The canonical SMILES for 2-bromo-N,N-dioctylacetamide is CCCCCCCCN(CCCCCCCC)C(=O)CBr.
What is the InChIKey of 2-bromo-N,N-dioctylacetamide?
The InChIKey is XEFDAMQSIJLBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36BrNO/c1-3-5-7-9-11-13-15-20(18(21)17-19)16-14-12-10-8-6-4-2/h3-17H2,1-2H3.
What are the key properties of 2-bromo-N,N-dioctylacetamide?
2-bromo-N,N-dioctylacetamide has a molecular weight of 362.40 g/mol, XLogP of 5.93, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N,N-dioctylacetamide is sourced from PubChem (CID 532882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).