C22H18Cl2N4O2 — CID 5328832
2-N,4-N-bis(3-chlorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine (PubChem CID 5328832) has the molecular formula C22H18Cl2N4O2 and a molecular weight of 441.32 g/mol. Its IUPAC name is 2-N,4-N-bis(3-chlorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3-chlorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 5328832 |
| Molecular Formula | C22H18Cl2N4O2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-N,4-N-bis(3-chlorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine |
| SMILES | COc1cc2nc(Nc3cccc(Cl)c3)nc(Nc3cccc(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C22H18Cl2N4O2/c1-29-19-11-17-18(12-20(19)30-2)27-22(26-16-8-4-6-14(24)10-16)28-21(17)25-15-7-3-5-13(23)9-15/h3-12H,1-2H3,(H2,25,26,27,28) |
| InChIKey | GSIJXOGHJUOJKI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |