About 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile
4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile (PubChem CID 5328847) has the molecular formula C20H17N3O3
and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
| PubChem CID | 5328847 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(Nc3cccc(C(C)=O)c3)c2cc1OC |
| InChI | InChI=1S/C20H17N3O3/c1-12(24)13-5-4-6-15(7-13)23-20-14(10-21)11-22-17-9-19(26-3)18(25-2)8-16(17)20/h4-9,11H,1-3H3,(H,22,23) |
| InChIKey | IGMHTUVNOCQQMP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile?
The IUPAC name of 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile (CID 5328847) is 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile.
What is the SMILES notation for 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile?
The canonical SMILES for 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile is COc1cc2ncc(C#N)c(Nc3cccc(C(C)=O)c3)c2cc1OC.
What is the InChIKey of 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile?
The InChIKey is IGMHTUVNOCQQMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O3/c1-12(24)13-5-4-6-15(7-13)23-20-14(10-21)11-22-17-9-19(26-3)18(25-2)8-16(17)20/h4-9,11H,1-3H3,(H,22,23).
What are the key properties of 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile?
4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile has a molecular weight of 347.37 g/mol, XLogP of 4.07, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-acetylanilino)-6,7-dimethoxyquinoline-3-carbonitrile is sourced from PubChem (CID 5328847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).