About N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide
N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide (PubChem CID 5328872) has the molecular formula C20H18N4O3
and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide |
| PubChem CID | 5328872 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide |
| SMILES | COc1cc2ncc(C#N)c(Nc3cccc(NC(C)=O)c3)c2cc1OC |
| InChI | InChI=1S/C20H18N4O3/c1-12(25)23-14-5-4-6-15(7-14)24-20-13(10-21)11-22-17-9-19(27-3)18(26-2)8-16(17)20/h4-9,11H,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | ADTHOQASRLCLRF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide?
The IUPAC name of N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide (CID 5328872) is N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide.
What is the SMILES notation for N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide?
The canonical SMILES for N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide is COc1cc2ncc(C#N)c(Nc3cccc(NC(C)=O)c3)c2cc1OC.
What is the InChIKey of N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide?
The InChIKey is ADTHOQASRLCLRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O3/c1-12(25)23-14-5-4-6-15(7-14)24-20-13(10-21)11-22-17-9-19(27-3)18(26-2)8-16(17)20/h4-9,11H,1-3H3,(H,22,24)(H,23,25).
What are the key properties of N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide?
N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide has a molecular weight of 362.39 g/mol, XLogP of 3.83, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]phenyl]acetamide is sourced from PubChem (CID 5328872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).