About N,N-dihexylpentanamide
N,N-dihexylpentanamide (PubChem CID 532888) has the molecular formula C17H35NO
and a molecular weight of 269.47 g/mol. Its IUPAC name is N,N-dihexylpentanamide.
Molecular Properties
| Compound Name | N,N-dihexylpentanamide |
| PubChem CID | 532888 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | N,N-dihexylpentanamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)CCCC |
| InChI | InChI=1S/C17H35NO/c1-4-7-10-12-15-18(16-13-11-8-5-2)17(19)14-9-6-3/h4-16H2,1-3H3 |
| InChIKey | JMPFRSTVOKJKHS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihexylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihexylpentanamide?
The IUPAC name of N,N-dihexylpentanamide (CID 532888) is N,N-dihexylpentanamide.
What is the SMILES notation for N,N-dihexylpentanamide?
The canonical SMILES for N,N-dihexylpentanamide is CCCCCCN(CCCCCC)C(=O)CCCC.
What is the InChIKey of N,N-dihexylpentanamide?
The InChIKey is JMPFRSTVOKJKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO/c1-4-7-10-12-15-18(16-13-11-8-5-2)17(19)14-9-6-3/h4-16H2,1-3H3.
What are the key properties of N,N-dihexylpentanamide?
N,N-dihexylpentanamide has a molecular weight of 269.47 g/mol, XLogP of 5.17, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihexylpentanamide is sourced from PubChem (CID 532888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).