C25H27ClN4O4 — CID 5328930
4-(2-chloro-5-methoxyanilino)-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinoline-3-carbonitrile (PubChem CID 5328930) has the molecular formula C25H27ClN4O4 and a molecular weight of 482.97 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxyanilino)-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinoline-3-carbonitrile.
| Compound Name | 4-(2-chloro-5-methoxyanilino)-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5328930 |
| Molecular Formula | C25H27ClN4O4 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 4-(2-chloro-5-methoxyanilino)-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinoline-3-carbonitrile |
| SMILES | COc1ccc(Cl)c(Nc2c(C#N)cnc3cc(OCCCN4CCOCC4)c(OC)cc23)c1 |
| InChI | InChI=1S/C25H27ClN4O4/c1-31-18-4-5-20(26)22(12-18)29-25-17(15-27)16-28-21-14-24(23(32-2)13-19(21)25)34-9-3-6-30-7-10-33-11-8-30/h4-5,12-14,16H,3,6-11H2,1-2H3,(H,28,29) |
| InChIKey | GJTWFSFZLIOXFD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|