C17H15Cl2N5O — CID 5328994
1-[7-amino-3-(2,6-dichlorophenyl)-1,6-naphthyridin-2-yl]-3-ethylurea (PubChem CID 5328994) has the molecular formula C17H15Cl2N5O and a molecular weight of 376.25 g/mol. Its IUPAC name is 1-[7-amino-3-(2,6-dichlorophenyl)-1,6-naphthyridin-2-yl]-3-ethylurea.
| Compound Name | 1-[7-amino-3-(2,6-dichlorophenyl)-1,6-naphthyridin-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 5328994 |
| Molecular Formula | C17H15Cl2N5O |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 1-[7-amino-3-(2,6-dichlorophenyl)-1,6-naphthyridin-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2cc(N)ncc2cc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H15Cl2N5O/c1-2-21-17(25)24-16-10(15-11(18)4-3-5-12(15)19)6-9-8-22-14(20)7-13(9)23-16/h3-8H,2H2,1H3,(H2,20,22)(H2,21,23,24,25) |
| InChIKey | SHMZPLWJQVFWLG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |