C16H16N4O2 — CID 5328996
3-(3,5-dimethoxyphenyl)-1,6-naphthyridine-2,7-diamine (PubChem CID 5328996) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-1,6-naphthyridine-2,7-diamine.
| Compound Name | 3-(3,5-dimethoxyphenyl)-1,6-naphthyridine-2,7-diamine |
|---|---|
| PubChem CID | 5328996 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-1,6-naphthyridine-2,7-diamine |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(N)cc3nc2N)c1 |
| InChI | InChI=1S/C16H16N4O2/c1-21-11-3-9(4-12(6-11)22-2)13-5-10-8-19-15(17)7-14(10)20-16(13)18/h3-8H,1-2H3,(H2,17,19)(H2,18,20) |
| InChIKey | XXQRJTXNOCEQLF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |