C21H25N5O3 — CID 5328999
1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-tert-butylurea (PubChem CID 5328999) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-tert-butylurea.
| Compound Name | 1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-tert-butylurea |
|---|---|
| PubChem CID | 5328999 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-tert-butylurea |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(N)cc3nc2NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C21H25N5O3/c1-21(2,3)26-20(27)25-19-16(8-13-11-23-18(22)10-17(13)24-19)12-6-14(28-4)9-15(7-12)29-5/h6-11H,1-5H3,(H2,22,23)(H2,24,25,26,27) |
| InChIKey | MCZADMNBTWSHHB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |