C23H21N5O3 — CID 5329000
1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-phenylurea (PubChem CID 5329000) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-phenylurea.
| Compound Name | 1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 5329000 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-[7-amino-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]-3-phenylurea |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(N)cc3nc2NC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C23H21N5O3/c1-30-17-8-14(9-18(11-17)31-2)19-10-15-13-25-21(24)12-20(15)27-22(19)28-23(29)26-16-6-4-3-5-7-16/h3-13H,1-2H3,(H2,24,25)(H2,26,27,28,29) |
| InChIKey | GVPPAUNFTPWQSI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |