C16H13ClFN3O2 — CID 5329006
N-(4-chloro-2-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine (PubChem CID 5329006) has the molecular formula C16H13ClFN3O2 and a molecular weight of 333.75 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-(4-chloro-2-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 5329006 |
| Molecular Formula | C16H13ClFN3O2 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(Cl)cc3F)c2cc1OC |
| InChI | InChI=1S/C16H13ClFN3O2/c1-22-14-6-10-13(7-15(14)23-2)19-8-20-16(10)21-12-4-3-9(17)5-11(12)18/h3-8H,1-2H3,(H,19,20,21) |
| InChIKey | YHUIUSRCUKUUQA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |