C21H19N4O5S+ — CID 53290180
4-[2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one (PubChem CID 53290180) has the molecular formula C21H19N4O5S+ and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-[2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53290180 |
| Molecular Formula | C21H19N4O5S+ |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 4-[2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
| SMILES | CCn1c(SCC(=O)c2c(=O)o[nH][n+]2-c2ccc(OC)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H18N4O5S/c1-3-24-19(27)15-6-4-5-7-16(15)22-21(24)31-12-17(26)18-20(28)30-23-25(18)13-8-10-14(29-2)11-9-13/h4-11H,3,12H2,1-2H3/p+1 |
| InChIKey | UTAZCYYFUWQPEO-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|