C19H19FN4O4 — CID 5329031
N-[4-(2-fluoro-5-hydroxy-4-methylanilino)-6-methoxyquinazolin-7-yl]-2-methoxyacetamide (PubChem CID 5329031) has the molecular formula C19H19FN4O4 and a molecular weight of 386.38 g/mol. Its IUPAC name is N-[4-(2-fluoro-5-hydroxy-4-methylanilino)-6-methoxyquinazolin-7-yl]-2-methoxyacetamide.
| Compound Name | N-[4-(2-fluoro-5-hydroxy-4-methylanilino)-6-methoxyquinazolin-7-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 5329031 |
| Molecular Formula | C19H19FN4O4 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[4-(2-fluoro-5-hydroxy-4-methylanilino)-6-methoxyquinazolin-7-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc2ncnc(Nc3cc(O)c(C)cc3F)c2cc1OC |
| InChI | InChI=1S/C19H19FN4O4/c1-10-4-12(20)14(7-16(10)25)24-19-11-5-17(28-3)15(23-18(26)8-27-2)6-13(11)21-9-22-19/h4-7,9,25H,8H2,1-3H3,(H,23,26)(H,21,22,24) |
| InChIKey | SGKBYSBTZYZOJQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |