C24H28BrN7O2 — CID 5329088
(E)-N'-[4-(3-bromoanilino)pyrido[3,4-d]pyrimidin-6-yl]-N-[3-(diethylamino)propyl]but-2-enediamide (PubChem CID 5329088) has the molecular formula C24H28BrN7O2 and a molecular weight of 526.44 g/mol. Its IUPAC name is (E)-N'-[4-(3-bromoanilino)pyrido[3,4-d]pyrimidin-6-yl]-N-[3-(diethylamino)propyl]but-2-enediamide.
| Compound Name | (E)-N'-[4-(3-bromoanilino)pyrido[3,4-d]pyrimidin-6-yl]-N-[3-(diethylamino)propyl]but-2-enediamide |
|---|---|
| PubChem CID | 5329088 |
| Molecular Formula | C24H28BrN7O2 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | (E)-N'-[4-(3-bromoanilino)pyrido[3,4-d]pyrimidin-6-yl]-N-[3-(diethylamino)propyl]but-2-enediamide |
| SMILES | CCN(CC)CCCNC(=O)/C=C/C(=O)Nc1cc2c(Nc3cccc(Br)c3)ncnc2cn1 |
| InChI | InChI=1S/C24H28BrN7O2/c1-3-32(4-2)12-6-11-26-22(33)9-10-23(34)31-21-14-19-20(15-27-21)28-16-29-24(19)30-18-8-5-7-17(25)13-18/h5,7-10,13-16H,3-4,6,11-12H2,1-2H3,(H,26,33)(H,27,31,34)(H,28,29,30)/b10-9+ |
| InChIKey | TYPAATJNKNDNOD-MDZDMXLPSA-N |
| XLogP | 3.87 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|