C15H11BrN4OS — CID 5329097
N-(3-bromophenyl)-6-ethenylsulfinylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 5329097) has the molecular formula C15H11BrN4OS and a molecular weight of 375.25 g/mol. Its IUPAC name is N-(3-bromophenyl)-6-ethenylsulfinylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-(3-bromophenyl)-6-ethenylsulfinylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 5329097 |
| Molecular Formula | C15H11BrN4OS |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | N-(3-bromophenyl)-6-ethenylsulfinylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | C=CS(=O)c1cc2c(Nc3cccc(Br)c3)ncnc2cn1 |
| InChI | InChI=1S/C15H11BrN4OS/c1-2-22(21)14-7-12-13(8-17-14)18-9-19-15(12)20-11-5-3-4-10(16)6-11/h2-9H,1H2,(H,18,19,20) |
| InChIKey | UIYHGNBEHXNFBN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |