C20H23N3O6S2 — CID 53291649
4-[2-(4-ethoxycarbonylpiperidine-1-carbothioyl)sulfanylacetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 53291649) has the molecular formula C20H23N3O6S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is 4-[2-(4-ethoxycarbonylpiperidine-1-carbothioyl)sulfanylacetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-(4-ethoxycarbonylpiperidine-1-carbothioyl)sulfanylacetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53291649 |
| Molecular Formula | C20H23N3O6S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-[2-(4-ethoxycarbonylpiperidine-1-carbothioyl)sulfanylacetyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | CCOC(=O)C1CCN(C(=S)SCC(=O)c2c([O-])on[n+]2-c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H23N3O6S2/c1-3-28-18(25)13-8-10-22(11-9-13)20(30)31-12-16(24)17-19(26)29-21-23(17)14-4-6-15(27-2)7-5-14/h4-7,13H,3,8-12H2,1-2H3 |
| InChIKey | BXFOZNFISZDLKG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 108.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|