C27H26N2O4 — CID 5329169
3-[2-[(Z)-[6-(3-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1H-indol-3-yl]propanoic acid (PubChem CID 5329169) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[2-[(Z)-[6-(3-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1H-indol-3-yl]propanoic acid.
| Compound Name | 3-[2-[(Z)-[6-(3-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 5329169 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-[2-[(Z)-[6-(3-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1H-indol-3-yl]propanoic acid |
| SMILES | COc1cccc(-c2ccc3c(c2)NC(=O)/C3=C\c2[nH]c3c(c2CCC(=O)O)CCCC3)c1 |
| InChI | InChI=1S/C27H26N2O4/c1-33-18-6-4-5-16(13-18)17-9-10-21-22(27(32)29-24(21)14-17)15-25-20(11-12-26(30)31)19-7-2-3-8-23(19)28-25/h4-6,9-10,13-15,28H,2-3,7-8,11-12H2,1H3,(H,29,32)(H,30,31)/b22-15- |
| InChIKey | FUXHNAHZJZOIIP-JCMHNJIXSA-N |
| XLogP | 5.08 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|